C43H34SSi — CID 169293747
[4-[4-[7-(4-dibenzothiophen-4-ylphenyl)naphthalen-2-yl]phenyl]phenyl]-trimethylsilane (PubChem CID 169293747) has the molecular formula C43H34SSi and a molecular weight of 610.90 g/mol. Its IUPAC name is [4-[4-[7-(4-dibenzothiophen-4-ylphenyl)naphthalen-2-yl]phenyl]phenyl]-trimethylsilane.
| Compound Name | [4-[4-[7-(4-dibenzothiophen-4-ylphenyl)naphthalen-2-yl]phenyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 169293747 |
| Molecular Formula | C43H34SSi |
| Molecular Weight | 610.90 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | [4-[4-[7-(4-dibenzothiophen-4-ylphenyl)naphthalen-2-yl]phenyl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc(-c3ccc4ccc(-c5ccc(-c6cccc7c6sc6ccccc67)cc5)cc4c3)cc2)cc1 |
| InChI | InChI=1S/C43H34SSi/c1-45(2,3)38-25-23-30(24-26-38)29-11-13-31(14-12-29)35-21-17-33-18-22-36(28-37(33)27-35)32-15-19-34(20-16-32)39-8-6-9-41-40-7-4-5-10-42(40)44-43(39)41/h4-28H,1-3H3 |
| InChIKey | GKQBUKGASAIYSD-UHFFFAOYSA-N |
| XLogP | 12.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.90 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|