C41H42IrN2OSi-2 — CID 164797092
[4-[4-(7,7-dimethyl-2-bicyclo[2.2.1]heptanyl)-2-pyridinyl]-3H-dibenzofuran-3-id-1-yl]-trimethylsilane;iridium;4-methyl-2-phenylpyridine (PubChem CID 164797092) has the molecular formula C41H42IrN2OSi-2 and a molecular weight of 799.10 g/mol. Its IUPAC name is [4-[4-(7,7-dimethyl-2-bicyclo[2.2.1]heptanyl)-2-pyridinyl]-3H-dibenzofuran-3-id-1-yl]-trimethylsilane;iridium;4-methyl-2-phenylpyridine.
| Compound Name | [4-[4-(7,7-dimethyl-2-bicyclo[2.2.1]heptanyl)-2-pyridinyl]-3H-dibenzofuran-3-id-1-yl]-trimethylsilane;iridium;4-methyl-2-phenylpyridine |
|---|---|
| PubChem CID | 164797092 |
| Molecular Formula | C41H42IrN2OSi-2 |
| Molecular Weight | 799.10 g/mol |
| Exact Mass | 799.27 |
| IUPAC Name | [4-[4-(7,7-dimethyl-2-bicyclo[2.2.1]heptanyl)-2-pyridinyl]-3H-dibenzofuran-3-id-1-yl]-trimethylsilane;iridium;4-methyl-2-phenylpyridine |
| SMILES | CC1(C)C2CCC1C(c1ccnc(-c3[c-]cc([Si](C)(C)C)c4c3oc3ccccc34)c1)C2.Cc1ccnc(-c2[c-]cccc2)c1.[Ir] |
| InChI | InChI=1S/C29H32NOSi.C12H10N.Ir/c1-29(2)19-10-12-23(29)22(17-19)18-14-15-30-24(16-18)20-11-13-26(32(3,4)5)27-21-8-6-7-9-25(21)31-28(20)27;1-10-7-8-13-12(9-10)11-5-3-2-4-6-11;/h6-9,13-16,19,22-23H,10,12,17H2,1-5H3;2-5,7-9H,1H3;/q2*-1; |
| InChIKey | QWDBXMNGLSVOCM-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.10 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|