C43H40IrN2O2Si-2 — CID 169291867
CID 169291867 (PubChem CID 169291867) has the molecular formula C43H40IrN2O2Si-2 and a molecular weight of 837.11 g/mol.
| Compound Name | CID 169291867 |
|---|---|
| PubChem CID | 169291867 |
| Molecular Formula | C43H40IrN2O2Si-2 |
| Molecular Weight | 837.11 g/mol |
| Exact Mass | 837.25 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.Cc1cnc(-c2[c-]c3oc4ccccc4c3c3c2oc2ccccc23)cc1CC(C)(C)C.[Ir] |
| InChI | InChI=1S/C29H24NO2.C14H16NSi.Ir/c1-17-16-30-22(13-18(17)15-29(2,3)4)21-14-25-26(19-9-5-7-11-23(19)31-25)27-20-10-6-8-12-24(20)32-28(21)27;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h5-13,16H,15H2,1-4H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | KTQQFALCUJZEGS-UHFFFAOYSA-N |
| XLogP | 11.34 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.11 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|