C46H38IrN2O2Si-2 — CID 169291860
CID 169291860 (PubChem CID 169291860) has the molecular formula C46H38IrN2O2Si-2 and a molecular weight of 871.13 g/mol.
| Compound Name | CID 169291860 |
|---|---|
| PubChem CID | 169291860 |
| Molecular Formula | C46H38IrN2O2Si-2 |
| Molecular Weight | 871.13 g/mol |
| Exact Mass | 871.23 |
| IUPAC Name | — |
| SMILES | CC(C)c1ccnc(-c2[c-]c3oc4ccccc4c3c3c2oc2cc(-c4ccccc4)ccc23)c1.C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C32H22NO2.C14H16NSi.Ir/c1-19(2)21-14-15-33-26(16-21)25-18-29-30(23-10-6-7-11-27(23)34-29)31-24-13-12-22(17-28(24)35-32(25)31)20-8-4-3-5-9-20;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h3-17,19H,1-2H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | YAAWDLAUPVLECT-UHFFFAOYSA-N |
| XLogP | 12.23 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.13 |
| LogP ≤ 5 | 12.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|