C35H34IrN2OSi-2 — CID 169291733
6-tert-butyl-3-phenyl-[1]benzofuro[3,2-c]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane (PubChem CID 169291733) has the molecular formula C35H34IrN2OSi-2 and a molecular weight of 718.97 g/mol. Its IUPAC name is 6-tert-butyl-3-phenyl-[1]benzofuro[3,2-c]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane.
| Compound Name | 6-tert-butyl-3-phenyl-[1]benzofuro[3,2-c]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 169291733 |
| Molecular Formula | C35H34IrN2OSi-2 |
| Molecular Weight | 718.97 g/mol |
| Exact Mass | 719.21 |
| IUPAC Name | 6-tert-butyl-3-phenyl-[1]benzofuro[3,2-c]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
| SMILES | CC(C)(C)c1cccc2c1oc1cc(-c3[c-]cccc3)ncc12.C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C21H18NO.C14H16NSi.Ir/c1-21(2,3)17-11-7-10-15-16-13-22-18(12-19(16)23-20(15)17)14-8-5-4-6-9-14;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h4-8,10-13H,1-3H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | NMSFYUYFSXYTFA-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.97 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|