C40H36IrN2OSi2-2 — CID 177109827
CID 177109827 (PubChem CID 177109827) has the molecular formula C40H36IrN2OSi2-2 and a molecular weight of 809.13 g/mol.
| Compound Name | CID 177109827 |
|---|---|
| PubChem CID | 177109827 |
| Molecular Formula | C40H36IrN2OSi2-2 |
| Molecular Weight | 809.13 g/mol |
| Exact Mass | 809.20 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.Cc1ccnc(-c2[c-]ccc3c2oc2cc4c(cc23)[Si](C)(C)c2ccccc2-4)c1.[Ir] |
| InChI | InChI=1S/C26H20NOSi.C14H16NSi.Ir/c1-16-11-12-27-22(13-16)19-9-6-8-18-20-15-25-21(14-23(20)28-26(18)19)17-7-4-5-10-24(17)29(25,2)3;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h4-8,10-15H,1-3H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | IFETUMSLUBGTFC-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.13 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|