C37H28IrN2OSi-2 — CID 177109830
CID 177109830 (PubChem CID 177109830) has the molecular formula C37H28IrN2OSi-2 and a molecular weight of 739.97 g/mol.
| Compound Name | CID 177109830 |
|---|---|
| PubChem CID | 177109830 |
| Molecular Formula | C37H28IrN2OSi-2 |
| Molecular Weight | 739.97 g/mol |
| Exact Mass | 740.18 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1ccnc(-c2[c-]ccc3c2oc2cc4c(cc23)[Si](C)(C)c2ccccc2-4)c1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C26H20NOSi.C11H8N.Ir/c1-16-11-12-27-22(13-16)19-9-6-8-18-20-15-25-21(14-23(20)28-26(18)19)17-7-4-5-10-24(17)29(25,2)3;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h4-8,10-15H,1-3H3;1-6,8-9H;/q2*-1;/i1D3;; |
| InChIKey | RCYPOMZZYVQANQ-GXXYEPOPSA-N |
| XLogP | 8.11 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.97 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|