C41H38GeIrN2OSi-2 — CID 177109850
CID 177109850 (PubChem CID 177109850) has the molecular formula C41H38GeIrN2OSi-2 and a molecular weight of 867.68 g/mol.
| Compound Name | CID 177109850 |
|---|---|
| PubChem CID | 177109850 |
| Molecular Formula | C41H38GeIrN2OSi-2 |
| Molecular Weight | 867.68 g/mol |
| Exact Mass | 869.16 |
| IUPAC Name | — |
| SMILES | C[Ge](C)(C)c1ccc(-c2[c-]cccc2)nc1.Cc1cnc(-c2[c-]ccc3c2oc2cc4c(cc23)-c2ccccc2[Si]4(C)C)cc1C.[Ir] |
| InChI | InChI=1S/C27H22NOSi.C14H16GeN.Ir/c1-16-12-23(28-15-17(16)2)20-10-7-9-19-21-13-22-18-8-5-6-11-25(18)30(3,4)26(22)14-24(21)29-27(19)20;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h5-9,11-15H,1-4H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | FBGOIGASVZMHHL-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.68 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|