C42H30IrN2O-2 — CID 162707093
5-benzyl-2-phenylpyridine;2-(3H-dibenzofuran-3-id-4-yl)-5-methyl-4-phenylpyridine;iridium (PubChem CID 162707093) has the molecular formula C42H30IrN2O-2 and a molecular weight of 770.93 g/mol. Its IUPAC name is 5-benzyl-2-phenylpyridine;2-(3H-dibenzofuran-3-id-4-yl)-5-methyl-4-phenylpyridine;iridium.
| Compound Name | 5-benzyl-2-phenylpyridine;2-(3H-dibenzofuran-3-id-4-yl)-5-methyl-4-phenylpyridine;iridium |
|---|---|
| PubChem CID | 162707093 |
| Molecular Formula | C42H30IrN2O-2 |
| Molecular Weight | 770.93 g/mol |
| Exact Mass | 771.20 |
| IUPAC Name | 5-benzyl-2-phenylpyridine;2-(3H-dibenzofuran-3-id-4-yl)-5-methyl-4-phenylpyridine;iridium |
| SMILES | Cc1cnc(-c2[c-]ccc3c2oc2ccccc23)cc1-c1ccccc1.[Ir].[c-]1ccccc1-c1ccc(Cc2ccccc2)cn1 |
| InChI | InChI=1S/C24H16NO.C18H14N.Ir/c1-16-15-25-22(14-21(16)17-8-3-2-4-9-17)20-12-7-11-19-18-10-5-6-13-23(18)26-24(19)20;1-3-7-15(8-4-1)13-16-11-12-18(19-14-16)17-9-5-2-6-10-17;/h2-11,13-15H,1H3;1-9,11-12,14H,13H2;/q2*-1; |
| InChIKey | BSULPLSRGRQCHT-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.93 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|