C67H45FIrN3O — CID 176729019
5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)ethyl]phenyl]-4-fluorophenyl]-2-(3H-dibenzofuran-3-id-4-yl)-4-(4-phenylphenyl)pyridine;iridium(3+) (PubChem CID 176729019) has the molecular formula C67H45FIrN3O and a molecular weight of 1119.33 g/mol. Its IUPAC name is 5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)ethyl]phenyl]-4-fluorophenyl]-2-(3H-dibenzofuran-3-id-4-yl)-4-(4-phenylphenyl)pyridine;iridium(3+).
| Compound Name | 5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)ethyl]phenyl]-4-fluorophenyl]-2-(3H-dibenzofuran-3-id-4-yl)-4-(4-phenylphenyl)pyridine;iridium(3+) |
|---|---|
| PubChem CID | 176729019 |
| Molecular Formula | C67H45FIrN3O |
| Molecular Weight | 1119.33 g/mol |
| Exact Mass | 1119.32 |
| IUPAC Name | 5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)ethyl]phenyl]-4-fluorophenyl]-2-(3H-dibenzofuran-3-id-4-yl)-4-(4-phenylphenyl)pyridine;iridium(3+) |
| SMILES | Fc1ccc(-c2cnc(-c3[c-]ccc4c3oc3ccccc34)cc2-c2ccc(-c3ccccc3)cc2)c(-c2cc(CCc3ccc(-c4[c-]cccc4)nc3)cc(CCc3ccc(-c4[c-]cccc4)nc3)c2)c1.[Ir+3] |
| InChI | InChI=1S/C67H45FN3O.Ir/c68-55-33-34-56(62-44-71-65(59-21-12-20-58-57-19-10-11-22-66(57)72-67(58)59)41-61(62)51-31-29-50(30-32-51)49-13-4-1-5-14-49)60(40-55)54-38-47(25-23-45-27-35-63(69-42-45)52-15-6-2-7-16-52)37-48(39-54)26-24-46-28-36-64(70-43-46)53-17-8-3-9-18-53;/h1-15,17,19-20,22,27-44H,23-26H2;/q-3;+3 |
| InChIKey | LDFZPDSEDTYHNY-UHFFFAOYSA-N |
| XLogP | 16.55 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1119.33 |
| LogP ≤ 5 | 16.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|