C61H40F2IrN3O — CID 165149028
5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)ethyl]phenyl]phenyl]-4-(4,6-difluorodibenzofuran-3-yl)-2-phenylpyridine;iridium(3+) (PubChem CID 165149028) has the molecular formula C61H40F2IrN3O and a molecular weight of 1061.22 g/mol. Its IUPAC name is 5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)ethyl]phenyl]phenyl]-4-(4,6-difluorodibenzofuran-3-yl)-2-phenylpyridine;iridium(3+).
| Compound Name | 5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)ethyl]phenyl]phenyl]-4-(4,6-difluorodibenzofuran-3-yl)-2-phenylpyridine;iridium(3+) |
|---|---|
| PubChem CID | 165149028 |
| Molecular Formula | C61H40F2IrN3O |
| Molecular Weight | 1061.22 g/mol |
| Exact Mass | 1061.28 |
| IUPAC Name | 5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)ethyl]phenyl]phenyl]-4-(4,6-difluorodibenzofuran-3-yl)-2-phenylpyridine;iridium(3+) |
| SMILES | Fc1cccc2c1oc1c(F)c(-c3cc(-c4[c-]cccc4)ncc3-c3ccccc3-c3cc(CCc4ccc(-c5[c-]cccc5)nc4)cc(CCc4ccc(-c5[c-]cccc5)nc4)c3)ccc12.[Ir+3] |
| InChI | InChI=1S/C61H40F2N3O.Ir/c62-55-22-12-21-51-52-30-29-50(59(63)61(52)67-60(51)55)53-36-58(46-17-8-3-9-18-46)66-39-54(53)49-20-11-10-19-48(49)47-34-42(25-23-40-27-31-56(64-37-40)44-13-4-1-5-14-44)33-43(35-47)26-24-41-28-32-57(65-38-41)45-15-6-2-7-16-45;/h1-13,15,17,19-22,27-39H,23-26H2;/q-3;+3 |
| InChIKey | UIRKRPSSSJCTTJ-UHFFFAOYSA-N |
| XLogP | 15.02 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1061.22 |
| LogP ≤ 5 | 15.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|