C59H42IrN5 — CID 165148568
5-[5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)ethyl]phenyl]phenyl]-2-phenyl-4-pyridinyl]-2-phenylpyrimidine;iridium(3+) (PubChem CID 165148568) has the molecular formula C59H42IrN5 and a molecular weight of 1013.24 g/mol. Its IUPAC name is 5-[5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)ethyl]phenyl]phenyl]-2-phenyl-4-pyridinyl]-2-phenylpyrimidine;iridium(3+).
| Compound Name | 5-[5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)ethyl]phenyl]phenyl]-2-phenyl-4-pyridinyl]-2-phenylpyrimidine;iridium(3+) |
|---|---|
| PubChem CID | 165148568 |
| Molecular Formula | C59H42IrN5 |
| Molecular Weight | 1013.24 g/mol |
| Exact Mass | 1013.31 |
| IUPAC Name | 5-[5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)ethyl]phenyl]phenyl]-2-phenyl-4-pyridinyl]-2-phenylpyrimidine;iridium(3+) |
| SMILES | [Ir+3].[c-]1ccccc1-c1ccc(CCc2cc(CCc3ccc(-c4[c-]cccc4)nc3)cc(-c3ccccc3-c3cnc(-c4[c-]cccc4)cc3-c3cnc(-c4ccccc4)nc3)c2)cn1 |
| InChI | InChI=1S/C59H42N5.Ir/c1-5-15-46(16-6-1)56-31-29-42(37-60-56)25-27-44-33-45(28-26-43-30-32-57(61-38-43)47-17-7-2-8-18-47)35-50(34-44)52-23-13-14-24-53(52)55-41-62-58(48-19-9-3-10-20-48)36-54(55)51-39-63-59(64-40-51)49-21-11-4-12-22-49;/h1-15,17,19,21-24,29-41H,25-28H2;/q-3;+3 |
| InChIKey | STZDHDKFUMVOIF-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.24 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|