C75H48IrN3 — CID 153458738
5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)phenyl]phenyl]phenyl]-2-phenyl-4-[3-(4-phenylphenyl)phenyl]pyridine;iridium(3+) (PubChem CID 153458738) has the molecular formula C75H48IrN3 and a molecular weight of 1183.45 g/mol. Its IUPAC name is 5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)phenyl]phenyl]phenyl]-2-phenyl-4-[3-(4-phenylphenyl)phenyl]pyridine;iridium(3+).
| Compound Name | 5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)phenyl]phenyl]phenyl]-2-phenyl-4-[3-(4-phenylphenyl)phenyl]pyridine;iridium(3+) |
|---|---|
| PubChem CID | 153458738 |
| Molecular Formula | C75H48IrN3 |
| Molecular Weight | 1183.45 g/mol |
| Exact Mass | 1183.35 |
| IUPAC Name | 5-[2-[3,5-bis[2-(6-phenyl-3-pyridinyl)phenyl]phenyl]phenyl]-2-phenyl-4-[3-(4-phenylphenyl)phenyl]pyridine;iridium(3+) |
| SMILES | [Ir+3].[c-]1ccccc1-c1ccc(-c2ccccc2-c2cc(-c3ccccc3-c3ccc(-c4[c-]cccc4)nc3)cc(-c3ccccc3-c3cnc(-c4[c-]cccc4)cc3-c3cccc(-c4ccc(-c5ccccc5)cc4)c3)c2)cn1 |
| InChI | InChI=1S/C75H48N3.Ir/c1-5-20-52(21-6-1)53-36-38-54(39-37-53)58-28-19-29-59(44-58)71-48-75(57-26-11-4-12-27-57)78-51-72(71)70-35-18-17-34-69(70)64-46-62(67-32-15-13-30-65(67)60-40-42-73(76-49-60)55-22-7-2-8-23-55)45-63(47-64)68-33-16-14-31-66(68)61-41-43-74(77-50-61)56-24-9-3-10-25-56;/h1-22,24,26,28-51H;/q-3;+3 |
| InChIKey | JYNBAVUETQRCOE-UHFFFAOYSA-N |
| XLogP | 19.27 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1183.45 |
| LogP ≤ 5 | 19.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|