C69H46IrN3 — CID 167363064
iridium(3+);2-phenyl-4-(4-phenylphenyl)pyridine;2-phenyl-5-[2-[3-(2-phenylphenyl)-5-(2-pyridin-3-ylphenyl)phenyl]phenyl]pyridine (PubChem CID 167363064) has the molecular formula C69H46IrN3 and a molecular weight of 1109.37 g/mol. Its IUPAC name is iridium(3+);2-phenyl-4-(4-phenylphenyl)pyridine;2-phenyl-5-[2-[3-(2-phenylphenyl)-5-(2-pyridin-3-ylphenyl)phenyl]phenyl]pyridine.
| Compound Name | iridium(3+);2-phenyl-4-(4-phenylphenyl)pyridine;2-phenyl-5-[2-[3-(2-phenylphenyl)-5-(2-pyridin-3-ylphenyl)phenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 167363064 |
| Molecular Formula | C69H46IrN3 |
| Molecular Weight | 1109.37 g/mol |
| Exact Mass | 1109.33 |
| IUPAC Name | iridium(3+);2-phenyl-4-(4-phenylphenyl)pyridine;2-phenyl-5-[2-[3-(2-phenylphenyl)-5-(2-pyridin-3-ylphenyl)phenyl]phenyl]pyridine |
| SMILES | [Ir+3].[c-]1cccc(-c2ccccc2-c2cc(-c3ccccc3-c3cccnc3)cc(-c3ccccc3-c3ccc(-c4[c-]cccc4)nc3)c2)c1.[c-]1ccccc1-c1cc(-c2ccc(-c3ccccc3)cc2)ccn1 |
| InChI | InChI=1S/C46H30N2.C23H16N.Ir/c1-3-14-33(15-4-1)40-19-7-10-22-43(40)37-28-38(44-23-11-8-20-41(44)35-18-13-27-47-31-35)30-39(29-37)45-24-12-9-21-42(45)36-25-26-46(48-32-36)34-16-5-2-6-17-34;1-3-7-18(8-4-1)19-11-13-20(14-12-19)22-15-16-24-23(17-22)21-9-5-2-6-10-21;/h1-3,5-16,18-32H;1-9,11-17H;/q-2;-1;+3 |
| InChIKey | BLRPEFHFNOSQQW-UHFFFAOYSA-N |
| XLogP | 17.63 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1109.37 |
| LogP ≤ 5 | 17.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|