C64H43IrN3O2-2 — CID 167362970
benzoic acid;5-[2-[3,5-bis(2-pyridin-3-ylphenyl)phenyl]phenyl]-2-phenyl-4-(4-phenylphenyl)pyridine;iridium (PubChem CID 167362970) has the molecular formula C64H43IrN3O2-2 and a molecular weight of 1078.28 g/mol. Its IUPAC name is benzoic acid;5-[2-[3,5-bis(2-pyridin-3-ylphenyl)phenyl]phenyl]-2-phenyl-4-(4-phenylphenyl)pyridine;iridium.
| Compound Name | benzoic acid;5-[2-[3,5-bis(2-pyridin-3-ylphenyl)phenyl]phenyl]-2-phenyl-4-(4-phenylphenyl)pyridine;iridium |
|---|---|
| PubChem CID | 167362970 |
| Molecular Formula | C64H43IrN3O2-2 |
| Molecular Weight | 1078.28 g/mol |
| Exact Mass | 1078.30 |
| IUPAC Name | benzoic acid;5-[2-[3,5-bis(2-pyridin-3-ylphenyl)phenyl]phenyl]-2-phenyl-4-(4-phenylphenyl)pyridine;iridium |
| SMILES | O=C(O)c1[c-]cccc1.[Ir].[c-]1ccccc1-c1cc(-c2ccc(-c3ccccc3)cc2)c(-c2ccccc2-c2cc(-c3ccccc3-c3cccnc3)cc(-c3ccccc3-c3cccnc3)c2)cn1 |
| InChI | InChI=1S/C57H38N3.C7H5O2.Ir/c1-3-15-40(16-4-1)41-27-29-42(30-28-41)55-36-57(43-17-5-2-6-18-43)60-39-56(55)54-26-12-11-25-53(54)48-34-46(51-23-9-7-21-49(51)44-19-13-31-58-37-44)33-47(35-48)52-24-10-8-22-50(52)45-20-14-32-59-38-45;8-7(9)6-4-2-1-3-5-6;/h1-17,19-39H;1-4H,(H,8,9);/q2*-1; |
| InChIKey | DOYMMNWUKLYUCU-UHFFFAOYSA-N |
| XLogP | 15.86 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1078.28 |
| LogP ≤ 5 | 15.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|