C69H53IrN3O2-2 — CID 167362980
5-[2-[3,5-bis(2-pyridin-3-ylphenyl)phenyl]phenyl]-2-phenyl-4-(4-phenylphenyl)pyridine;3-(2,2-dimethylpropyl)benzene-6-ide-1-carboxylic acid;iridium (PubChem CID 167362980) has the molecular formula C69H53IrN3O2-2 and a molecular weight of 1148.42 g/mol. Its IUPAC name is 5-[2-[3,5-bis(2-pyridin-3-ylphenyl)phenyl]phenyl]-2-phenyl-4-(4-phenylphenyl)pyridine;3-(2,2-dimethylpropyl)benzene-6-ide-1-carboxylic acid;iridium.
| Compound Name | 5-[2-[3,5-bis(2-pyridin-3-ylphenyl)phenyl]phenyl]-2-phenyl-4-(4-phenylphenyl)pyridine;3-(2,2-dimethylpropyl)benzene-6-ide-1-carboxylic acid;iridium |
|---|---|
| PubChem CID | 167362980 |
| Molecular Formula | C69H53IrN3O2-2 |
| Molecular Weight | 1148.42 g/mol |
| Exact Mass | 1148.38 |
| IUPAC Name | 5-[2-[3,5-bis(2-pyridin-3-ylphenyl)phenyl]phenyl]-2-phenyl-4-(4-phenylphenyl)pyridine;3-(2,2-dimethylpropyl)benzene-6-ide-1-carboxylic acid;iridium |
| SMILES | CC(C)(C)Cc1cc[c-]c(C(=O)O)c1.[Ir].[c-]1ccccc1-c1cc(-c2ccc(-c3ccccc3)cc2)c(-c2ccccc2-c2cc(-c3ccccc3-c3cccnc3)cc(-c3ccccc3-c3cccnc3)c2)cn1 |
| InChI | InChI=1S/C57H38N3.C12H15O2.Ir/c1-3-15-40(16-4-1)41-27-29-42(30-28-41)55-36-57(43-17-5-2-6-18-43)60-39-56(55)54-26-12-11-25-53(54)48-34-46(51-23-9-7-21-49(51)44-19-13-31-58-37-44)33-47(35-48)52-24-10-8-22-50(52)45-20-14-32-59-38-45;1-12(2,3)8-9-5-4-6-10(7-9)11(13)14;/h1-17,19-39H;4-5,7H,8H2,1-3H3,(H,13,14);/q2*-1; |
| InChIKey | ZIUPMQLILJVRQE-UHFFFAOYSA-N |
| XLogP | 17.45 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1148.42 |
| LogP ≤ 5 | 17.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|