C34H26IrN2OS-2 — CID 168829554
4,5-dimethyl-2-(2-methyl-8H-[1]benzothiolo[6,7-b][1]benzofuran-8-id-7-yl)pyridine;iridium;5-methyl-2-phenylpyridine (PubChem CID 168829554) has the molecular formula C34H26IrN2OS-2 and a molecular weight of 702.88 g/mol. Its IUPAC name is 4,5-dimethyl-2-(2-methyl-8H-[1]benzothiolo[6,7-b][1]benzofuran-8-id-7-yl)pyridine;iridium;5-methyl-2-phenylpyridine.
| Compound Name | 4,5-dimethyl-2-(2-methyl-8H-[1]benzothiolo[6,7-b][1]benzofuran-8-id-7-yl)pyridine;iridium;5-methyl-2-phenylpyridine |
|---|---|
| PubChem CID | 168829554 |
| Molecular Formula | C34H26IrN2OS-2 |
| Molecular Weight | 702.88 g/mol |
| Exact Mass | 703.14 |
| IUPAC Name | 4,5-dimethyl-2-(2-methyl-8H-[1]benzothiolo[6,7-b][1]benzofuran-8-id-7-yl)pyridine;iridium;5-methyl-2-phenylpyridine |
| SMILES | Cc1cc2ccc3oc4c(-c5cc(C)c(C)cn5)[c-]ccc4c3c2s1.Cc1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C22H16NOS.C12H10N.Ir/c1-12-9-18(23-11-13(12)2)16-5-4-6-17-20-19(24-21(16)17)8-7-15-10-14(3)25-22(15)20;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h4,6-11H,1-3H3;2-5,7-9H,1H3;/q2*-1; |
| InChIKey | TZCFMUHINCEQLQ-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.88 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|