C36H30IrN2OS-2 — CID 168829924
2-(7H-[1]benzothiolo[5,6-b][1]benzofuran-7-id-8-yl)-4-tert-butyl-5-methylpyridine;iridium;5-methyl-2-phenylpyridine (PubChem CID 168829924) has the molecular formula C36H30IrN2OS-2 and a molecular weight of 730.93 g/mol. Its IUPAC name is 2-(7H-[1]benzothiolo[5,6-b][1]benzofuran-7-id-8-yl)-4-tert-butyl-5-methylpyridine;iridium;5-methyl-2-phenylpyridine.
| Compound Name | 2-(7H-[1]benzothiolo[5,6-b][1]benzofuran-7-id-8-yl)-4-tert-butyl-5-methylpyridine;iridium;5-methyl-2-phenylpyridine |
|---|---|
| PubChem CID | 168829924 |
| Molecular Formula | C36H30IrN2OS-2 |
| Molecular Weight | 730.93 g/mol |
| Exact Mass | 731.17 |
| IUPAC Name | 2-(7H-[1]benzothiolo[5,6-b][1]benzofuran-7-id-8-yl)-4-tert-butyl-5-methylpyridine;iridium;5-methyl-2-phenylpyridine |
| SMILES | Cc1ccc(-c2[c-]cccc2)nc1.Cc1cnc(-c2[c-]ccc3c2oc2cc4ccsc4cc23)cc1C(C)(C)C.[Ir] |
| InChI | InChI=1S/C24H20NOS.C12H10N.Ir/c1-14-13-25-20(12-19(14)24(2,3)4)17-7-5-6-16-18-11-22-15(8-9-27-22)10-21(18)26-23(16)17;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h5-6,8-13H,1-4H3;2-5,7-9H,1H3;/q2*-1; |
| InChIKey | RMSMUYVUJKEYQD-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.93 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|