C32H22IrN2OS-2 — CID 168829933
iridium;5-methyl-2-phenylpyridine;2,3,4,5-tetradeuterio-6-(2-methyl-7H-[1]benzothiolo[5,6-b][1]benzofuran-7-id-8-yl)pyridine (PubChem CID 168829933) has the molecular formula C32H22IrN2OS-2 and a molecular weight of 678.85 g/mol. Its IUPAC name is iridium;5-methyl-2-phenylpyridine;2,3,4,5-tetradeuterio-6-(2-methyl-7H-[1]benzothiolo[5,6-b][1]benzofuran-7-id-8-yl)pyridine.
| Compound Name | iridium;5-methyl-2-phenylpyridine;2,3,4,5-tetradeuterio-6-(2-methyl-7H-[1]benzothiolo[5,6-b][1]benzofuran-7-id-8-yl)pyridine |
|---|---|
| PubChem CID | 168829933 |
| Molecular Formula | C32H22IrN2OS-2 |
| Molecular Weight | 678.85 g/mol |
| Exact Mass | 679.13 |
| IUPAC Name | iridium;5-methyl-2-phenylpyridine;2,3,4,5-tetradeuterio-6-(2-methyl-7H-[1]benzothiolo[5,6-b][1]benzofuran-7-id-8-yl)pyridine |
| SMILES | Cc1ccc(-c2[c-]cccc2)nc1.[2H]c1nc(-c2[c-]ccc3c2oc2cc4cc(C)sc4cc23)c([2H])c([2H])c1[2H].[Ir] |
| InChI | InChI=1S/C20H12NOS.C12H10N.Ir/c1-12-9-13-10-18-16(11-19(13)23-12)14-5-4-6-15(20(14)22-18)17-7-2-3-8-21-17;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h2-5,7-11H,1H3;2-5,7-9H,1H3;/q2*-1;/i2D,3D,7D,8D;; |
| InChIKey | NOLXYZIHAUWBGW-WBMRDMHDSA-N |
| XLogP | 8.83 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.85 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|