C31H20IrN2OS-2 — CID 168829834
2-(7H-[1]benzothiolo[5,6-b][1]benzofuran-7-id-8-yl)-3,4,5,6-tetradeuteriopyridine;iridium;5-methyl-2-phenylpyridine (PubChem CID 168829834) has the molecular formula C31H20IrN2OS-2 and a molecular weight of 664.82 g/mol. Its IUPAC name is 2-(7H-[1]benzothiolo[5,6-b][1]benzofuran-7-id-8-yl)-3,4,5,6-tetradeuteriopyridine;iridium;5-methyl-2-phenylpyridine.
| Compound Name | 2-(7H-[1]benzothiolo[5,6-b][1]benzofuran-7-id-8-yl)-3,4,5,6-tetradeuteriopyridine;iridium;5-methyl-2-phenylpyridine |
|---|---|
| PubChem CID | 168829834 |
| Molecular Formula | C31H20IrN2OS-2 |
| Molecular Weight | 664.82 g/mol |
| Exact Mass | 665.12 |
| IUPAC Name | 2-(7H-[1]benzothiolo[5,6-b][1]benzofuran-7-id-8-yl)-3,4,5,6-tetradeuteriopyridine;iridium;5-methyl-2-phenylpyridine |
| SMILES | Cc1ccc(-c2[c-]cccc2)nc1.[2H]c1nc(-c2[c-]ccc3c2oc2cc4ccsc4cc23)c([2H])c([2H])c1[2H].[Ir] |
| InChI | InChI=1S/C19H10NOS.C12H10N.Ir/c1-2-8-20-16(6-1)14-5-3-4-13-15-11-18-12(7-9-22-18)10-17(15)21-19(13)14;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h1-4,6-11H;2-5,7-9H,1H3;/q2*-1;/i1D,2D,6D,8D;; |
| InChIKey | NMFMTPJIJQFRCJ-SJVFWMFESA-N |
| XLogP | 8.52 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.82 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|