C31H20IrN2OS-2 — CID 168830080
2-(8H-[1]benzothiolo[6,7-b][1]benzofuran-8-id-7-yl)pyridine;iridium;5-methyl-2-phenylpyridine (PubChem CID 168830080) has the molecular formula C31H20IrN2OS-2 and a molecular weight of 660.80 g/mol. Its IUPAC name is 2-(8H-[1]benzothiolo[6,7-b][1]benzofuran-8-id-7-yl)pyridine;iridium;5-methyl-2-phenylpyridine.
| Compound Name | 2-(8H-[1]benzothiolo[6,7-b][1]benzofuran-8-id-7-yl)pyridine;iridium;5-methyl-2-phenylpyridine |
|---|---|
| PubChem CID | 168830080 |
| Molecular Formula | C31H20IrN2OS-2 |
| Molecular Weight | 660.80 g/mol |
| Exact Mass | 661.09 |
| IUPAC Name | 2-(8H-[1]benzothiolo[6,7-b][1]benzofuran-8-id-7-yl)pyridine;iridium;5-methyl-2-phenylpyridine |
| SMILES | Cc1ccc(-c2[c-]cccc2)nc1.[Ir].[c-]1ccc2c(oc3ccc4ccsc4c32)c1-c1ccccn1 |
| InChI | InChI=1S/C19H10NOS.C12H10N.Ir/c1-2-10-20-15(6-1)13-4-3-5-14-17-16(21-18(13)14)8-7-12-9-11-22-19(12)17;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h1-3,5-11H;2-5,7-9H,1H3;/q2*-1; |
| InChIKey | UJOYMQVLEGQCMQ-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.80 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|