C35H28IrN2OS-2 — CID 168829787
2-(8H-[1]benzothiolo[7,6-b][1]benzofuran-8-id-9-yl)-4-tert-butylpyridine;iridium;5-methyl-2-phenylpyridine (PubChem CID 168829787) has the molecular formula C35H28IrN2OS-2 and a molecular weight of 716.91 g/mol. Its IUPAC name is 2-(8H-[1]benzothiolo[7,6-b][1]benzofuran-8-id-9-yl)-4-tert-butylpyridine;iridium;5-methyl-2-phenylpyridine.
| Compound Name | 2-(8H-[1]benzothiolo[7,6-b][1]benzofuran-8-id-9-yl)-4-tert-butylpyridine;iridium;5-methyl-2-phenylpyridine |
|---|---|
| PubChem CID | 168829787 |
| Molecular Formula | C35H28IrN2OS-2 |
| Molecular Weight | 716.91 g/mol |
| Exact Mass | 717.16 |
| IUPAC Name | 2-(8H-[1]benzothiolo[7,6-b][1]benzofuran-8-id-9-yl)-4-tert-butylpyridine;iridium;5-methyl-2-phenylpyridine |
| SMILES | CC(C)(C)c1ccnc(-c2[c-]ccc3c2oc2c3ccc3ccsc32)c1.Cc1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C23H18NOS.C12H10N.Ir/c1-23(2,3)15-9-11-24-19(13-15)18-6-4-5-16-17-8-7-14-10-12-26-22(14)21(17)25-20(16)18;1-10-7-8-12(13-9-10)11-5-3-2-4-6-11;/h4-5,7-13H,1-3H3;2-5,7-9H,1H3;/q2*-1; |
| InChIKey | OVZAEPCMROWWIJ-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.91 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|