About CID 169040331
CID 169040331 (PubChem CID 169040331) has the molecular formula C37H24IrN2O-2
and a molecular weight of 707.85 g/mol.
Molecular Properties
| Compound Name | CID 169040331 |
| PubChem CID | 169040331 |
| Molecular Formula | C37H24IrN2O-2 |
| Molecular Weight | 707.85 g/mol |
| Exact Mass | 708.17 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1ccnc(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)c1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C26H16NO.C11H8N.Ir/c1-16-11-12-27-24(13-16)21-8-4-7-20-23-14-18-10-9-17-5-2-3-6-19(17)22(18)15-25(23)28-26(20)21;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-7,9-15H,1H3;1-6,8-9H;/q2*-1;/i1D3;; |
| InChIKey | JARWLVCTVQLAOM-GXXYEPOPSA-N |
| XLogP | 9.61 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 707.85 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 169040331 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169040331?
The IUPAC name of CID 169040331 (CID 169040331) is not available.
What is the SMILES notation for CID 169040331?
The canonical SMILES for CID 169040331 is [2H]C([2H])([2H])c1ccnc(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)c1.[Ir].[c-]1ccccc1-c1ccccn1.
What is the InChIKey of CID 169040331?
The InChIKey is JARWLVCTVQLAOM-GXXYEPOPSA-N. The full InChI is InChI=1S/C26H16NO.C11H8N.Ir/c1-16-11-12-27-24(13-16)21-8-4-7-20-23-14-18-10-9-17-5-2-3-6-19(17)22(18)15-25(23)28-26(20)21;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-7,9-15H,1H3;1-6,8-9H;/q2*-1;/i1D3;;.
What are the key properties of CID 169040331?
CID 169040331 has a molecular weight of 707.85 g/mol, XLogP of 9.61, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169040331 is sourced from PubChem (CID 169040331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).