C44H36IrN2O-2 — CID 169040326
CID 169040326 (PubChem CID 169040326) has the molecular formula C44H36IrN2O-2 and a molecular weight of 802.01 g/mol.
| Compound Name | CID 169040326 |
|---|---|
| PubChem CID | 169040326 |
| Molecular Formula | C44H36IrN2O-2 |
| Molecular Weight | 802.01 g/mol |
| Exact Mass | 802.25 |
| IUPAC Name | — |
| SMILES | [2H]C1(c2ccnc(-c3[c-]ccc4c3oc3cc5c(ccc6ccccc65)cc34)c2)CCC(C)(C)CC1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C33H28NO.C11H8N.Ir/c1-33(2)15-12-21(13-16-33)23-14-17-34-30(19-23)27-9-5-8-26-29-18-24-11-10-22-6-3-4-7-25(22)28(24)20-31(29)35-32(26)27;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h3-8,10-11,14,17-21H,12-13,15-16H2,1-2H3;1-6,8-9H;/q2*-1;/i21D;; |
| InChIKey | RSRIADVPIZKNCY-LZNRWZRQSA-N |
| XLogP | 11.98 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.01 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|