C65H70IrN2O-2 — CID 176583782
CID 176583782 (PubChem CID 176583782) has the molecular formula C65H70IrN2O-2 and a molecular weight of 1094.55 g/mol.
| Compound Name | CID 176583782 |
|---|---|
| PubChem CID | 176583782 |
| Molecular Formula | C65H70IrN2O-2 |
| Molecular Weight | 1094.55 g/mol |
| Exact Mass | 1094.56 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2cc(C(C)(C)C)ccn2)cc1-c1c(C(C)C)cc(C(C)C)cc1C(C)C.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)cc1C1([2H])CCC(C)(C)CC1.[Ir] |
| InChI | InChI=1S/C34H30NO.C31H40N.Ir/c1-21-20-35-31(18-28(21)23-13-15-34(2,3)16-14-23)27-10-6-9-26-30-17-24-12-11-22-7-4-5-8-25(22)29(24)19-32(30)36-33(26)27;1-19(2)24-16-26(20(3)4)30(27(17-24)21(5)6)28-15-23(12-11-22(28)7)29-18-25(13-14-32-29)31(8,9)10;/h4-9,11-12,17-20,23H,13-16H2,1-3H3;11,13-21H,1-10H3;/q2*-1;/i1D3,23D;7D3; |
| InChIKey | FMONUFALVNZEHP-KYYMWQBCSA-N |
| XLogP | 18.94 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1094.55 |
| LogP ≤ 5 | 18.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|