C62H66IrN2O-2 — CID 176583936
CID 176583936 (PubChem CID 176583936) has the molecular formula C62H66IrN2O-2 and a molecular weight of 1055.49 g/mol.
| Compound Name | CID 176583936 |
|---|---|
| PubChem CID | 176583936 |
| Molecular Formula | C62H66IrN2O-2 |
| Molecular Weight | 1055.49 g/mol |
| Exact Mass | 1055.53 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2cc(C(C)(C)C)ccn2)cc1-c1c(C(C)C)cc(C(C)C)cc1C(C)C.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)cc1C([2H])([2H])C(C)(C)C.[Ir] |
| InChI | InChI=1S/C31H26NO.C31H40N.Ir/c1-19-18-32-28(15-22(19)17-31(2,3)4)25-11-7-10-24-27-14-21-13-12-20-8-5-6-9-23(20)26(21)16-29(27)33-30(24)25;1-19(2)24-16-26(20(3)4)30(27(17-24)21(5)6)28-15-23(12-11-22(28)7)29-18-25(13-14-32-29)31(8,9)10;/h5-10,12-16,18H,17H2,1-4H3;11,13-21H,1-10H3;/q2*-1;/i1D3,17D2;7D3; |
| InChIKey | HEXQXRKKIRVQOU-XUPHKFJFSA-N |
| XLogP | 17.84 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1055.49 |
| LogP ≤ 5 | 17.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|