C67H72IrN2O-2 — CID 177270942
CID 177270942 (PubChem CID 177270942) has the molecular formula C67H72IrN2O-2 and a molecular weight of 1121.59 g/mol.
| Compound Name | CID 177270942 |
|---|---|
| PubChem CID | 177270942 |
| Molecular Formula | C67H72IrN2O-2 |
| Molecular Weight | 1121.59 g/mol |
| Exact Mass | 1121.58 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2ccc(C(C)(C)C)cn2)cc1-c1c2c(cc3c1C(C)(C)CC3(C)C)C(C)(C)CC2(C)C.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)cc1C([2H])([2H])C(C)(C)C.[Ir] |
| InChI | InChI=1S/C36H46N.C31H26NO.Ir/c1-22-13-14-23(28-16-15-24(19-37-28)32(2,3)4)17-25(22)29-30-26(33(5,6)20-35(30,9)10)18-27-31(29)36(11,12)21-34(27,7)8;1-19-18-32-28(15-22(19)17-31(2,3)4)25-11-7-10-24-27-14-21-13-12-20-8-5-6-9-23(20)26(21)16-29(27)33-30(24)25;/h13,15-19H,20-21H2,1-12H3;5-10,12-16,18H,17H2,1-4H3;/q2*-1;/i1D3;1D3,17D2; |
| InChIKey | VFWIIMVQDUYZEL-YKZPQUTJSA-N |
| XLogP | 18.39 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1121.59 |
| LogP ≤ 5 | 18.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|