C58H52FIrN3O-2 — CID 176865627
CID 176865627 (PubChem CID 176865627) has the molecular formula C58H52FIrN3O-2 and a molecular weight of 1023.32 g/mol.
| Compound Name | CID 176865627 |
|---|---|
| PubChem CID | 176865627 |
| Molecular Formula | C58H52FIrN3O-2 |
| Molecular Weight | 1023.32 g/mol |
| Exact Mass | 1023.40 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC(C)(C)c2cc(-n3c(-c4[c-]cc(F)cc4)nc4ccccc43)ccc21.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)cc1C([2H])([2H])C(C)(C)C.[Ir] |
| InChI | InChI=1S/C31H26NO.C27H26FN2.Ir/c1-19-18-32-28(15-22(19)17-31(2,3)4)25-11-7-10-24-27-14-21-13-12-20-8-5-6-9-23(20)26(21)16-29(27)33-30(24)25;1-26(2)15-16-27(3,4)22-17-20(13-14-21(22)26)30-24-8-6-5-7-23(24)29-25(30)18-9-11-19(28)12-10-18;/h5-10,12-16,18H,17H2,1-4H3;5-9,11-14,17H,15-16H2,1-4H3;/q2*-1;/i1D3,17D2;; |
| InChIKey | KXNDGESNVZIORW-SWTWTNFSSA-N |
| XLogP | 15.63 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.32 |
| LogP ≤ 5 | 15.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|