C62H70IrN2O-2 — CID 176822432
CID 176822432 (PubChem CID 176822432) has the molecular formula C62H70IrN2O-2 and a molecular weight of 1056.50 g/mol.
| Compound Name | CID 176822432 |
|---|---|
| PubChem CID | 176822432 |
| Molecular Formula | C62H70IrN2O-2 |
| Molecular Weight | 1056.50 g/mol |
| Exact Mass | 1056.54 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1c[c-]c(-c2cc3c(cn2)C(C)(C)CCC3(C)C)cc1.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2cc4c(ccc5cc6c(cc54)C(C)(C)CCC6(C)C)cc23)cc1C([2H])([2H])C(C)(C)C.[Ir] |
| InChI | InChI=1S/C39H40NO.C23H30N.Ir/c1-23-22-40-34(18-26(23)21-37(2,3)4)28-11-9-10-27-31-16-24-12-13-25-17-32-33(39(7,8)15-14-38(32,5)6)19-29(25)30(24)20-35(31)41-36(27)28;1-21(2,3)17-10-8-16(9-11-17)20-14-18-19(15-24-20)23(6,7)13-12-22(18,4)5;/h9-10,12-13,16-20,22H,14-15,21H2,1-8H3;8,10-11,14-15H,12-13H2,1-7H3;/q2*-1;/i1D3,21D2;; |
| InChIKey | HZMGYYNDLKTDGT-LXPAMUFUSA-N |
| XLogP | 17.19 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1056.50 |
| LogP ≤ 5 | 17.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|