C42H31FIrN2OS-2 — CID 169301448
CID 169301448 (PubChem CID 169301448) has the molecular formula C42H31FIrN2OS-2 and a molecular weight of 828.04 g/mol.
| Compound Name | CID 169301448 |
|---|---|
| PubChem CID | 169301448 |
| Molecular Formula | C42H31FIrN2OS-2 |
| Molecular Weight | 828.04 g/mol |
| Exact Mass | 828.21 |
| IUPAC Name | — |
| SMILES | Fc1c[c-]c2c(c1)sc1cccnc12.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)cc1C([2H])([2H])C(C)(C)C.[Ir] |
| InChI | InChI=1S/C31H26NO.C11H5FNS.Ir/c1-19-18-32-28(15-22(19)17-31(2,3)4)25-11-7-10-24-27-14-21-13-12-20-8-5-6-9-23(20)26(21)16-29(27)33-30(24)25;12-7-3-4-8-10(6-7)14-9-2-1-5-13-11(8)9;/h5-10,12-16,18H,17H2,1-4H3;1-3,5-6H;/q2*-1;/i1D3,17D2;; |
| InChIKey | KRBDFPGYFXXEJB-SWTWTNFSSA-N |
| XLogP | 12.04 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.04 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|