C59H60IrN2OSi-2 — CID 176584000
CID 176584000 (PubChem CID 176584000) has the molecular formula C59H60IrN2OSi-2 and a molecular weight of 1041.49 g/mol.
| Compound Name | CID 176584000 |
|---|---|
| PubChem CID | 176584000 |
| Molecular Formula | C59H60IrN2OSi-2 |
| Molecular Weight | 1041.49 g/mol |
| Exact Mass | 1041.46 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2cc([Si](C)(C)C)ccn2)cc1-c1ccc2c(c1)C(C)(C)CC2(C)C.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)cc1C([2H])([2H])C(C)(C)C.[Ir] |
| InChI | InChI=1S/C31H26NO.C28H34NSi.Ir/c1-19-18-32-28(15-22(19)17-31(2,3)4)25-11-7-10-24-27-14-21-13-12-20-8-5-6-9-23(20)26(21)16-29(27)33-30(24)25;1-19-9-10-21(26-17-22(13-14-29-26)30(6,7)8)15-23(19)20-11-12-24-25(16-20)28(4,5)18-27(24,2)3;/h5-10,12-16,18H,17H2,1-4H3;9,11-17H,18H2,1-8H3;/q2*-1;/i1D3,17D2;1D3; |
| InChIKey | AABVLBOTZLKSOA-PZLCDTMQSA-N |
| XLogP | 15.68 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1041.49 |
| LogP ≤ 5 | 15.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|