C55H49IrN3O-2 — CID 176814998
CID 176814998 (PubChem CID 176814998) has the molecular formula C55H49IrN3O-2 and a molecular weight of 965.26 g/mol.
| Compound Name | CID 176814998 |
|---|---|
| PubChem CID | 176814998 |
| Molecular Formula | C55H49IrN3O-2 |
| Molecular Weight | 965.26 g/mol |
| Exact Mass | 965.38 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(-c2[c-]cccc2)nc2ccccc21.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)cc1C([2H])([2H])C(C)C.[Ir] |
| InChI | InChI=1S/C30H24NO.C25H25N2.Ir/c1-18(2)13-22-15-28(31-17-19(22)3)25-10-6-9-24-27-14-21-12-11-20-7-4-5-8-23(20)26(21)16-29(27)32-30(24)25;1-17(2)20-13-10-14-21(18(3)4)24(20)27-23-16-9-8-15-22(23)26-25(27)19-11-6-5-7-12-19;/h4-9,11-12,14-18H,13H2,1-3H3;5-11,13-18H,1-4H3;/q2*-1;/i3D3,13D2;; |
| InChIKey | DPIICBLMXNMNDZ-ACFWAZBHSA-N |
| XLogP | 15.00 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 965.26 |
| LogP ≤ 5 | 15.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|