C44H38FIrN3O-2 — CID 176784485
1-[2,6-di(propan-2-yl)phenyl]-2-(7-fluoro-3H-dibenzofuran-3-id-4-yl)benzimidazole;iridium;2-phenyl-4,5-bis(trideuteriomethyl)pyridine (PubChem CID 176784485) has the molecular formula C44H38FIrN3O-2 and a molecular weight of 842.06 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-2-(7-fluoro-3H-dibenzofuran-3-id-4-yl)benzimidazole;iridium;2-phenyl-4,5-bis(trideuteriomethyl)pyridine.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-2-(7-fluoro-3H-dibenzofuran-3-id-4-yl)benzimidazole;iridium;2-phenyl-4,5-bis(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 176784485 |
| Molecular Formula | C44H38FIrN3O-2 |
| Molecular Weight | 842.06 g/mol |
| Exact Mass | 842.30 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-2-(7-fluoro-3H-dibenzofuran-3-id-4-yl)benzimidazole;iridium;2-phenyl-4,5-bis(trideuteriomethyl)pyridine |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(-c2[c-]ccc3c2oc2cc(F)ccc23)nc2ccccc21.[2H]C([2H])([2H])c1cnc(-c2[c-]cccc2)cc1C([2H])([2H])[2H].[Ir] |
| InChI | InChI=1S/C31H26FN2O.C13H12N.Ir/c1-18(2)21-9-7-10-22(19(3)4)29(21)34-27-14-6-5-13-26(27)33-31(34)25-12-8-11-24-23-16-15-20(32)17-28(23)35-30(24)25;1-10-8-13(14-9-11(10)2)12-6-4-3-5-7-12;/h5-11,13-19H,1-4H3;3-6,8-9H,1-2H3;/q2*-1;/i;1D3,2D3; |
| InChIKey | KXJBMBKRPLMMAI-RUHQGNAASA-N |
| XLogP | 11.94 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.06 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|