C45H42FIrN3OSi-2 — CID 167332806
1-(2,6-dimethylphenyl)-2-(7-fluoro-3H-dibenzofuran-3-id-4-yl)benzimidazole;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane (PubChem CID 167332806) has the molecular formula C45H42FIrN3OSi-2 and a molecular weight of 880.15 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-2-(7-fluoro-3H-dibenzofuran-3-id-4-yl)benzimidazole;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane.
| Compound Name | 1-(2,6-dimethylphenyl)-2-(7-fluoro-3H-dibenzofuran-3-id-4-yl)benzimidazole;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
|---|---|
| PubChem CID | 167332806 |
| Molecular Formula | C45H42FIrN3OSi-2 |
| Molecular Weight | 880.15 g/mol |
| Exact Mass | 880.27 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-2-(7-fluoro-3H-dibenzofuran-3-id-4-yl)benzimidazole;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
| SMILES | CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.Cc1cccc(C)c1-n1c(-c2[c-]ccc3c2oc2cc(F)ccc23)nc2ccccc21.[Ir] |
| InChI | InChI=1S/C27H18FN2O.C18H24NSi.Ir/c1-16-7-5-8-17(2)25(16)30-23-12-4-3-11-22(23)29-27(30)21-10-6-9-20-19-14-13-18(28)15-24(19)31-26(20)21;1-14(2)11-16-12-17(15-9-7-6-8-10-15)19-13-18(16)20(3,4)5;/h3-9,11-15H,1-2H3;6-9,12-14H,11H2,1-5H3;/q2*-1; |
| InChIKey | HAHKVFFTGFPVDF-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.15 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|