C52H46FIrN3O2Si-2 — CID 156658041
1-dibenzofuran-4-yl-2-(7-fluoro-1-methyl-3H-dibenzofuran-3-id-4-yl)benzimidazole;[4-(2,3-dimethylbutyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium (PubChem CID 156658041) has the molecular formula C52H46FIrN3O2Si-2 and a molecular weight of 984.26 g/mol. Its IUPAC name is 1-dibenzofuran-4-yl-2-(7-fluoro-1-methyl-3H-dibenzofuran-3-id-4-yl)benzimidazole;[4-(2,3-dimethylbutyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium.
| Compound Name | 1-dibenzofuran-4-yl-2-(7-fluoro-1-methyl-3H-dibenzofuran-3-id-4-yl)benzimidazole;[4-(2,3-dimethylbutyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 156658041 |
| Molecular Formula | C52H46FIrN3O2Si-2 |
| Molecular Weight | 984.26 g/mol |
| Exact Mass | 984.30 |
| IUPAC Name | 1-dibenzofuran-4-yl-2-(7-fluoro-1-methyl-3H-dibenzofuran-3-id-4-yl)benzimidazole;[4-(2,3-dimethylbutyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
| SMILES | CC(C)C(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.Cc1c[c-]c(-c2nc3ccccc3n2-c2cccc3c2oc2ccccc23)c2oc3cc(F)ccc3c12.[Ir] |
| InChI | InChI=1S/C32H18FN2O2.C20H28NSi.Ir/c1-18-13-15-23(31-29(18)22-16-14-19(33)17-28(22)37-31)32-34-24-9-3-4-10-25(24)35(32)26-11-6-8-21-20-7-2-5-12-27(20)36-30(21)26;1-15(2)16(3)12-18-13-19(17-10-8-7-9-11-17)21-14-20(18)22(4,5)6;/h2-14,16-17H,1H3;7-10,13-16H,12H2,1-6H3;/q2*-1; |
| InChIKey | ZBUSDRZNCFJYIF-UHFFFAOYSA-N |
| XLogP | 13.67 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 984.26 |
| LogP ≤ 5 | 13.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|