C40H31IrN3O-2 — CID 177076014
2-(3H-dibenzofuran-3-id-4-yl)-4,5-bis(trideuteriomethyl)pyridine;1-(2,6-dimethylphenyl)-2-phenylbenzimidazole;iridium (PubChem CID 177076014) has the molecular formula C40H31IrN3O-2 and a molecular weight of 767.96 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-4-yl)-4,5-bis(trideuteriomethyl)pyridine;1-(2,6-dimethylphenyl)-2-phenylbenzimidazole;iridium.
| Compound Name | 2-(3H-dibenzofuran-3-id-4-yl)-4,5-bis(trideuteriomethyl)pyridine;1-(2,6-dimethylphenyl)-2-phenylbenzimidazole;iridium |
|---|---|
| PubChem CID | 177076014 |
| Molecular Formula | C40H31IrN3O-2 |
| Molecular Weight | 767.96 g/mol |
| Exact Mass | 768.25 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-4-yl)-4,5-bis(trideuteriomethyl)pyridine;1-(2,6-dimethylphenyl)-2-phenylbenzimidazole;iridium |
| SMILES | Cc1cccc(C)c1-n1c(-c2[c-]cccc2)nc2ccccc21.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2ccccc23)cc1C([2H])([2H])[2H].[Ir] |
| InChI | InChI=1S/C21H17N2.C19H14NO.Ir/c1-15-9-8-10-16(2)20(15)23-19-14-7-6-13-18(19)22-21(23)17-11-4-3-5-12-17;1-12-10-17(20-11-13(12)2)16-8-5-7-15-14-6-3-4-9-18(14)21-19(15)16;/h3-11,13-14H,1-2H3;3-7,9-11H,1-2H3;/q2*-1;/i;1D3,2D3; |
| InChIKey | ICBKTTVQGADFAR-RUHQGNAASA-N |
| XLogP | 10.17 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.96 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|