C48H38FIrN3O-2 — CID 166564111
1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-2-phenylbenzimidazole;2-(3H-dibenzofuran-3-id-4-yl)-5-(4-fluorophenyl)pyridine;iridium (PubChem CID 166564111) has the molecular formula C48H38FIrN3O-2 and a molecular weight of 886.08 g/mol. Its IUPAC name is 1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-2-phenylbenzimidazole;2-(3H-dibenzofuran-3-id-4-yl)-5-(4-fluorophenyl)pyridine;iridium.
| Compound Name | 1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-2-phenylbenzimidazole;2-(3H-dibenzofuran-3-id-4-yl)-5-(4-fluorophenyl)pyridine;iridium |
|---|---|
| PubChem CID | 166564111 |
| Molecular Formula | C48H38FIrN3O-2 |
| Molecular Weight | 886.08 g/mol |
| Exact Mass | 886.28 |
| IUPAC Name | 1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-2-phenylbenzimidazole;2-(3H-dibenzofuran-3-id-4-yl)-5-(4-fluorophenyl)pyridine;iridium |
| SMILES | Fc1ccc(-c2ccc(-c3[c-]ccc4c3oc3ccccc34)nc2)cc1.[2H]C(C)(C)c1cccc(C([2H])(C)C)c1-n1c(-c2[c-]cccc2)nc2ccccc21.[Ir] |
| InChI | InChI=1S/C25H25N2.C23H13FNO.Ir/c1-17(2)20-13-10-14-21(18(3)4)24(20)27-23-16-9-8-15-22(23)26-25(27)19-11-6-5-7-12-19;24-17-11-8-15(9-12-17)16-10-13-21(25-14-16)20-6-3-5-19-18-4-1-2-7-22(18)26-23(19)20;/h5-11,13-18H,1-4H3;1-5,7-14H;/q2*-1;/i17D,18D;; |
| InChIKey | TZMQKDWLTGCJAH-GXIIUUAHSA-N |
| XLogP | 12.99 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.08 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|