C51H47IrN3OSi-2 — CID 166563836
1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-2-phenylbenzimidazole;[4-[2-(3H-dibenzofuran-3-id-4-yl)-4-pyridinyl]phenyl]-trimethylsilane;iridium (PubChem CID 166563836) has the molecular formula C51H47IrN3OSi-2 and a molecular weight of 940.27 g/mol. Its IUPAC name is 1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-2-phenylbenzimidazole;[4-[2-(3H-dibenzofuran-3-id-4-yl)-4-pyridinyl]phenyl]-trimethylsilane;iridium.
| Compound Name | 1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-2-phenylbenzimidazole;[4-[2-(3H-dibenzofuran-3-id-4-yl)-4-pyridinyl]phenyl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 166563836 |
| Molecular Formula | C51H47IrN3OSi-2 |
| Molecular Weight | 940.27 g/mol |
| Exact Mass | 940.33 |
| IUPAC Name | 1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-2-phenylbenzimidazole;[4-[2-(3H-dibenzofuran-3-id-4-yl)-4-pyridinyl]phenyl]-trimethylsilane;iridium |
| SMILES | C[Si](C)(C)c1ccc(-c2ccnc(-c3[c-]ccc4c3oc3ccccc34)c2)cc1.[2H]C(C)(C)c1cccc(C([2H])(C)C)c1-n1c(-c2[c-]cccc2)nc2ccccc21.[Ir] |
| InChI | InChI=1S/C26H22NOSi.C25H25N2.Ir/c1-29(2,3)20-13-11-18(12-14-20)19-15-16-27-24(17-19)23-9-6-8-22-21-7-4-5-10-25(21)28-26(22)23;1-17(2)20-13-10-14-21(18(3)4)24(20)27-23-16-9-8-15-22(23)26-25(27)19-11-6-5-7-12-19;/h4-8,10-17H,1-3H3;5-11,13-18H,1-4H3;/q2*-1;/i;17D,18D; |
| InChIKey | XBAWGCYKCMKOLI-DPUNRQQVSA-N |
| XLogP | 13.40 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.27 |
| LogP ≤ 5 | 13.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|