C46H45IrN3-2 — CID 166563934
1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-2-phenylbenzimidazole;4-(4-tert-butylphenyl)-2-phenylpyridine;iridium (PubChem CID 166563934) has the molecular formula C46H45IrN3-2 and a molecular weight of 834.12 g/mol. Its IUPAC name is 1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-2-phenylbenzimidazole;4-(4-tert-butylphenyl)-2-phenylpyridine;iridium.
| Compound Name | 1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-2-phenylbenzimidazole;4-(4-tert-butylphenyl)-2-phenylpyridine;iridium |
|---|---|
| PubChem CID | 166563934 |
| Molecular Formula | C46H45IrN3-2 |
| Molecular Weight | 834.12 g/mol |
| Exact Mass | 834.34 |
| IUPAC Name | 1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-2-phenylbenzimidazole;4-(4-tert-butylphenyl)-2-phenylpyridine;iridium |
| SMILES | CC(C)(C)c1ccc(-c2ccnc(-c3[c-]cccc3)c2)cc1.[2H]C(C)(C)c1cccc(C([2H])(C)C)c1-n1c(-c2[c-]cccc2)nc2ccccc21.[Ir] |
| InChI | InChI=1S/C25H25N2.C21H20N.Ir/c1-17(2)20-13-10-14-21(18(3)4)24(20)27-23-16-9-8-15-22(23)26-25(27)19-11-6-5-7-12-19;1-21(2,3)19-11-9-16(10-12-19)18-13-14-22-20(15-18)17-7-5-4-6-8-17;/h5-11,13-18H,1-4H3;4-7,9-15H,1-3H3;/q2*-1;/i17D,18D;; |
| InChIKey | QOVCNQXSYHUUBH-GXIIUUAHSA-N |
| XLogP | 12.25 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.12 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|