C53H51IrN3-2 — CID 166564078
1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-6-phenyl-2-phenylbenzimidazole;5-[4-(1,1-dideuterio-2,2-dimethylpropyl)phenyl]-2-phenylpyridine;iridium (PubChem CID 166564078) has the molecular formula C53H51IrN3-2 and a molecular weight of 926.25 g/mol. Its IUPAC name is 1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-6-phenyl-2-phenylbenzimidazole;5-[4-(1,1-dideuterio-2,2-dimethylpropyl)phenyl]-2-phenylpyridine;iridium.
| Compound Name | 1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-6-phenyl-2-phenylbenzimidazole;5-[4-(1,1-dideuterio-2,2-dimethylpropyl)phenyl]-2-phenylpyridine;iridium |
|---|---|
| PubChem CID | 166564078 |
| Molecular Formula | C53H51IrN3-2 |
| Molecular Weight | 926.25 g/mol |
| Exact Mass | 926.40 |
| IUPAC Name | 1-[2,6-bis(2-deuteriopropan-2-yl)phenyl]-6-phenyl-2-phenylbenzimidazole;5-[4-(1,1-dideuterio-2,2-dimethylpropyl)phenyl]-2-phenylpyridine;iridium |
| SMILES | [2H]C(C)(C)c1cccc(C([2H])(C)C)c1-n1c(-c2[c-]cccc2)nc2ccc(-c3ccccc3)cc21.[2H]C([2H])(c1ccc(-c2ccc(-c3[c-]cccc3)nc2)cc1)C(C)(C)C.[Ir] |
| InChI | InChI=1S/C31H29N2.C22H22N.Ir/c1-21(2)26-16-11-17-27(22(3)4)30(26)33-29-20-25(23-12-7-5-8-13-23)18-19-28(29)32-31(33)24-14-9-6-10-15-24;1-22(2,3)15-17-9-11-18(12-10-17)20-13-14-21(23-16-20)19-7-5-4-6-8-19;/h5-14,16-22H,1-4H3;4-7,9-14,16H,15H2,1-3H3;/q2*-1;/i21D,22D;15D2; |
| InChIKey | PVKONKWEEGTNKH-AMNWPWBMSA-N |
| XLogP | 14.21 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.25 |
| LogP ≤ 5 | 14.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|