C39H31IrN3-2 — CID 153426870
iridium;5-phenyl-2-phenyl-1-(2-propan-2-ylphenyl)benzimidazole;2-phenylpyridine (PubChem CID 153426870) has the molecular formula C39H31IrN3-2 and a molecular weight of 733.92 g/mol. Its IUPAC name is iridium;5-phenyl-2-phenyl-1-(2-propan-2-ylphenyl)benzimidazole;2-phenylpyridine.
| Compound Name | iridium;5-phenyl-2-phenyl-1-(2-propan-2-ylphenyl)benzimidazole;2-phenylpyridine |
|---|---|
| PubChem CID | 153426870 |
| Molecular Formula | C39H31IrN3-2 |
| Molecular Weight | 733.92 g/mol |
| Exact Mass | 734.22 |
| IUPAC Name | iridium;5-phenyl-2-phenyl-1-(2-propan-2-ylphenyl)benzimidazole;2-phenylpyridine |
| SMILES | CC(C)c1ccccc1-n1c(-c2[c-]cccc2)nc2cc(-c3ccccc3)ccc21.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C28H23N2.C11H8N.Ir/c1-20(2)24-15-9-10-16-26(24)30-27-18-17-23(21-11-5-3-6-12-21)19-25(27)29-28(30)22-13-7-4-8-14-22;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h3-13,15-20H,1-2H3;1-6,8-9H;/q2*-1; |
| InChIKey | LXNQEIAHXVCJNE-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.92 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|