C50H41IrN3-2 — CID 164790859
iridium;2-(3H-phenanthren-3-id-2-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole;2-phenylpyridine (PubChem CID 164790859) has the molecular formula C50H41IrN3-2 and a molecular weight of 876.12 g/mol. Its IUPAC name is iridium;2-(3H-phenanthren-3-id-2-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole;2-phenylpyridine.
| Compound Name | iridium;2-(3H-phenanthren-3-id-2-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole;2-phenylpyridine |
|---|---|
| PubChem CID | 164790859 |
| Molecular Formula | C50H41IrN3-2 |
| Molecular Weight | 876.12 g/mol |
| Exact Mass | 876.29 |
| IUPAC Name | iridium;2-(3H-phenanthren-3-id-2-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]benzimidazole;2-phenylpyridine |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2[c-]cc3c(ccc4ccccc43)c2)nc2ccccc21.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C39H33N2.C11H8N.Ir/c1-25(2)34-23-31(27-12-6-5-7-13-27)24-35(26(3)4)38(34)41-37-17-11-10-16-36(37)40-39(41)30-20-21-33-29(22-30)19-18-28-14-8-9-15-32(28)33;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h5-19,21-26H,1-4H3;1-6,8-9H;/q2*-1; |
| InChIKey | PWLFCERGWMENDD-UHFFFAOYSA-N |
| XLogP | 13.26 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.12 |
| LogP ≤ 5 | 13.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|