C35H24IrN4-2 — CID 164826378
3,5-diphenyl-2-phenylimidazo[4,5-b]pyridine;iridium;2-phenylpyridine (PubChem CID 164826378) has the molecular formula C35H24IrN4-2 and a molecular weight of 692.82 g/mol. Its IUPAC name is 3,5-diphenyl-2-phenylimidazo[4,5-b]pyridine;iridium;2-phenylpyridine.
| Compound Name | 3,5-diphenyl-2-phenylimidazo[4,5-b]pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 164826378 |
| Molecular Formula | C35H24IrN4-2 |
| Molecular Weight | 692.82 g/mol |
| Exact Mass | 693.16 |
| IUPAC Name | 3,5-diphenyl-2-phenylimidazo[4,5-b]pyridine;iridium;2-phenylpyridine |
| SMILES | [Ir].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1nc2ccc(-c3ccccc3)nc2n1-c1ccccc1 |
| InChI | InChI=1S/C24H16N3.C11H8N.Ir/c1-4-10-18(11-5-1)21-16-17-22-24(25-21)27(20-14-8-3-9-15-20)23(26-22)19-12-6-2-7-13-19;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-12,14-17H;1-6,8-9H;/q2*-1; |
| InChIKey | LGACRJWNTUEYPY-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.82 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|