C41H26IrN4O-2 — CID 164825468
2-(3H-dibenzofuran-3-id-4-yl)-3,5-diphenylimidazo[4,5-b]pyridine;iridium;2-phenylpyridine (PubChem CID 164825468) has the molecular formula C41H26IrN4O-2 and a molecular weight of 782.90 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-4-yl)-3,5-diphenylimidazo[4,5-b]pyridine;iridium;2-phenylpyridine.
| Compound Name | 2-(3H-dibenzofuran-3-id-4-yl)-3,5-diphenylimidazo[4,5-b]pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 164825468 |
| Molecular Formula | C41H26IrN4O-2 |
| Molecular Weight | 782.90 g/mol |
| Exact Mass | 783.17 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-4-yl)-3,5-diphenylimidazo[4,5-b]pyridine;iridium;2-phenylpyridine |
| SMILES | [Ir].[c-]1ccc2c(oc3ccccc32)c1-c1nc2ccc(-c3ccccc3)nc2n1-c1ccccc1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C30H18N3O.C11H8N.Ir/c1-3-10-20(11-4-1)25-18-19-26-30(31-25)33(21-12-5-2-6-13-21)29(32-26)24-16-9-15-23-22-14-7-8-17-27(22)34-28(23)24;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-15,17-19H;1-6,8-9H;/q2*-1; |
| InChIKey | LOIQUNXCBOVHEJ-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.90 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|