C45H34IrN4O-2 — CID 164826330
5-tert-butyl-3-phenyl-2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)imidazo[4,5-b]pyridine;iridium;2-phenylpyridine (PubChem CID 164826330) has the molecular formula C45H34IrN4O-2 and a molecular weight of 839.01 g/mol. Its IUPAC name is 5-tert-butyl-3-phenyl-2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)imidazo[4,5-b]pyridine;iridium;2-phenylpyridine.
| Compound Name | 5-tert-butyl-3-phenyl-2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)imidazo[4,5-b]pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 164826330 |
| Molecular Formula | C45H34IrN4O-2 |
| Molecular Weight | 839.01 g/mol |
| Exact Mass | 839.24 |
| IUPAC Name | 5-tert-butyl-3-phenyl-2-(7-phenyl-3H-dibenzofuran-3-id-4-yl)imidazo[4,5-b]pyridine;iridium;2-phenylpyridine |
| SMILES | CC(C)(C)c1ccc2nc(-c3[c-]ccc4c3oc3cc(-c5ccccc5)ccc34)n(-c3ccccc3)c2n1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C34H26N3O.C11H8N.Ir/c1-34(2,3)30-20-19-28-33(36-30)37(24-13-8-5-9-14-24)32(35-28)27-16-10-15-26-25-18-17-23(21-29(25)38-31(26)27)22-11-6-4-7-12-22;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h4-15,17-21H,1-3H3;1-6,8-9H;/q2*-1; |
| InChIKey | MOXMATLNBJQQRP-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.01 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|