C44H29IrN3O-2 — CID 166010889
2-(3H-dibenzofuran-3-id-4-yl)-1-(2,6-diphenylphenyl)imidazole;iridium;2-phenylpyridine (PubChem CID 166010889) has the molecular formula C44H29IrN3O-2 and a molecular weight of 807.95 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-4-yl)-1-(2,6-diphenylphenyl)imidazole;iridium;2-phenylpyridine.
| Compound Name | 2-(3H-dibenzofuran-3-id-4-yl)-1-(2,6-diphenylphenyl)imidazole;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 166010889 |
| Molecular Formula | C44H29IrN3O-2 |
| Molecular Weight | 807.95 g/mol |
| Exact Mass | 808.20 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-4-yl)-1-(2,6-diphenylphenyl)imidazole;iridium;2-phenylpyridine |
| SMILES | [Ir].[c-]1ccc2c(oc3ccccc32)c1-c1nccn1-c1c(-c2ccccc2)cccc1-c1ccccc1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C33H21N2O.C11H8N.Ir/c1-3-11-23(12-4-1)25-16-9-17-26(24-13-5-2-6-14-24)31(25)35-22-21-34-33(35)29-19-10-18-28-27-15-7-8-20-30(27)36-32(28)29;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-18,20-22H;1-6,8-9H;/q2*-1; |
| InChIKey | DUJYBBJITWBQLG-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.95 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|