C33H21IrN2O- — CID 58947482
2-(3H-dibenzofuran-3-id-2-yl)-1-(2,6-diphenylphenyl)imidazole;iridium (PubChem CID 58947482) has the molecular formula C33H21IrN2O- and a molecular weight of 653.76 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-2-yl)-1-(2,6-diphenylphenyl)imidazole;iridium.
| Compound Name | 2-(3H-dibenzofuran-3-id-2-yl)-1-(2,6-diphenylphenyl)imidazole;iridium |
|---|---|
| PubChem CID | 58947482 |
| Molecular Formula | C33H21IrN2O- |
| Molecular Weight | 653.76 g/mol |
| Exact Mass | 654.13 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-2-yl)-1-(2,6-diphenylphenyl)imidazole;iridium |
| SMILES | [Ir].[c-]1cc2oc3ccccc3c2cc1-c1nccn1-c1c(-c2ccccc2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C33H21N2O.Ir/c1-3-10-23(11-4-1)26-15-9-16-27(24-12-5-2-6-13-24)32(26)35-21-20-34-33(35)25-18-19-31-29(22-25)28-14-7-8-17-30(28)36-31;/h1-17,19-22H;/q-1; |
| InChIKey | PRWXVZGLERTKFJ-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.76 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|