C27H25IrN2O- — CID 58400868
1-[2,4-di(propan-2-yl)dibenzofuran-3-yl]-2-phenylimidazole;iridium (PubChem CID 58400868) has the molecular formula C27H25IrN2O- and a molecular weight of 585.73 g/mol. Its IUPAC name is 1-[2,4-di(propan-2-yl)dibenzofuran-3-yl]-2-phenylimidazole;iridium.
| Compound Name | 1-[2,4-di(propan-2-yl)dibenzofuran-3-yl]-2-phenylimidazole;iridium |
|---|---|
| PubChem CID | 58400868 |
| Molecular Formula | C27H25IrN2O- |
| Molecular Weight | 585.73 g/mol |
| Exact Mass | 586.16 |
| IUPAC Name | 1-[2,4-di(propan-2-yl)dibenzofuran-3-yl]-2-phenylimidazole;iridium |
| SMILES | CC(C)c1cc2c(oc3ccccc32)c(C(C)C)c1-n1ccnc1-c1[c-]cccc1.[Ir] |
| InChI | InChI=1S/C27H25N2O.Ir/c1-17(2)21-16-22-20-12-8-9-13-23(20)30-26(22)24(18(3)4)25(21)29-15-14-28-27(29)19-10-6-5-7-11-19;/h5-10,12-18H,1-4H3;/q-1; |
| InChIKey | XWKRWKNQISOJCW-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.73 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|