C27H26N2O — CID 160847265
1-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-(1,1,1,2-tetradeuteriopropan-2-yl)dibenzofuran-3-yl]-2-phenylimidazole (PubChem CID 160847265) has the molecular formula C27H26N2O and a molecular weight of 405.59 g/mol. Its IUPAC name is 1-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-(1,1,1,2-tetradeuteriopropan-2-yl)dibenzofuran-3-yl]-2-phenylimidazole.
| Compound Name | 1-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-(1,1,1,2-tetradeuteriopropan-2-yl)dibenzofuran-3-yl]-2-phenylimidazole |
|---|---|
| PubChem CID | 160847265 |
| Molecular Formula | C27H26N2O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | 1-[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-(1,1,1,2-tetradeuteriopropan-2-yl)dibenzofuran-3-yl]-2-phenylimidazole |
| SMILES | [2H]C([2H])([2H])C([2H])(C)c1c(-n2ccnc2-c2ccccc2)c(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])cc2c1oc1ccccc12 |
| InChI | InChI=1S/C27H26N2O/c1-17(2)21-16-22-20-12-8-9-13-23(20)30-26(22)24(18(3)4)25(21)29-15-14-28-27(29)19-10-6-5-7-11-19/h5-18H,1-4H3/i1D3,2D3,3D3,17D,18D |
| InChIKey | IAKWWUOVBPGSAJ-BVGIEHGHSA-N |
| XLogP | 7.69 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |