C50H52N4OPt — CID 171723096
1-[[2,4-di(propan-2-yl)dibenzofuran-3-yl]methyl]-2-phenylimidazole;1-[[2,6-di(propan-2-yl)phenyl]methyl]-2-phenylimidazole;platinum(2+) (PubChem CID 171723096) has the molecular formula C50H52N4OPt and a molecular weight of 920.07 g/mol. Its IUPAC name is 1-[[2,4-di(propan-2-yl)dibenzofuran-3-yl]methyl]-2-phenylimidazole;1-[[2,6-di(propan-2-yl)phenyl]methyl]-2-phenylimidazole;platinum(2+).
| Compound Name | 1-[[2,4-di(propan-2-yl)dibenzofuran-3-yl]methyl]-2-phenylimidazole;1-[[2,6-di(propan-2-yl)phenyl]methyl]-2-phenylimidazole;platinum(2+) |
|---|---|
| PubChem CID | 171723096 |
| Molecular Formula | C50H52N4OPt |
| Molecular Weight | 920.07 g/mol |
| Exact Mass | 919.38 |
| IUPAC Name | 1-[[2,4-di(propan-2-yl)dibenzofuran-3-yl]methyl]-2-phenylimidazole;1-[[2,6-di(propan-2-yl)phenyl]methyl]-2-phenylimidazole;platinum(2+) |
| SMILES | CC(C)c1cc2c(oc3ccccc32)c(C(C)C)c1Cn1ccnc1-c1[c-]cccc1.CC(C)c1cccc(C(C)C)c1Cn1ccnc1-c1[c-]cccc1.[Pt+2] |
| InChI | InChI=1S/C28H27N2O.C22H25N2.Pt/c1-18(2)22-16-23-21-12-8-9-13-25(21)31-27(23)26(19(3)4)24(22)17-30-15-14-29-28(30)20-10-6-5-7-11-20;1-16(2)19-11-8-12-20(17(3)4)21(19)15-24-14-13-23-22(24)18-9-6-5-7-10-18;/h5-10,12-16,18-19H,17H2,1-4H3;5-9,11-14,16-17H,15H2,1-4H3;/q2*-1;+2 |
| InChIKey | NZBPFMJNBXMTNZ-UHFFFAOYSA-N |
| XLogP | 13.19 |
| TPSA | 48.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.07 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|